Difference between revisions of "MPBQ"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MPBQ == * common-name: ** 2-methyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-17351 == * smiles: ** cccccc=ccc=ccccccccccc(=o)[a glycerolipid] * common-name: ** a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17351 == |
| + | * smiles: | ||
| + | ** cccccc=ccc=ccccccccccc(=o)[a glycerolipid] | ||
* common-name: | * common-name: | ||
| − | ** | + | ** a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16099]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate}} |
| − | |||
| − | |||
Revision as of 15:24, 5 January 2021
Contents
Metabolite CPD-17351
- smiles:
- cccccc=ccc=ccccccccccc(=o)[a glycerolipid]
- common-name:
- a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
