Difference between revisions of "MPP-processed-mitochonrial-proteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11088 == * transcription-direction: ** negative * right-end-position: ** 136042 * left-end-position: ** 128302 * centisome-position: ** 33.726673...")
(Created page with "Category:metabolite == Metabolite CPD-11540 == * common-name: ** udp-4-dehydro-β-l-rhamnose * smiles: ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11088 ==
+
== Metabolite CPD-11540 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** udp-4-dehydro-β-l-rhamnose
−
* right-end-position:
+
* smiles:
−
** 136042
+
** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
−
* left-end-position:
+
* inchi-key:
−
** 128302
+
** ddwgqqadoimfoi-tyenrrdnsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 33.726673   
+
** 546.274
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10740]]
−
== Reaction(s) associated ==
+
* [[RXN-18332]]
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-18332]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[ALKAPHOSPHA-RXN]]
+
{{#set: common-name=udp-4-dehydro-β-l-rhamnose}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=ddwgqqadoimfoi-tyenrrdnsa-l}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=546.274}}
−
* [[RXN-5822]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8748]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[NAD-BIOSYNTHESIS-II]]
 
−
** '''4''' reactions found over '''3''' reactions in the full pathway
 
−
* [[NADPHOS-DEPHOS-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5083]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-5491]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=136042}}
 
−
{{#set: left-end-position=128302}}
 
−
{{#set: centisome-position=33.726673    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-11540

  • common-name:
    • udp-4-dehydro-β-l-rhamnose
  • smiles:
    • cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
  • inchi-key:
    • ddwgqqadoimfoi-tyenrrdnsa-l
  • molecular-weight:
    • 546.274

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=MPP-processed-mitochonrial-proteins&oldid=45853"