Difference between revisions of "MPP-processed-mitochonrial-proteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11540 == * common-name: ** udp-4-dehydro-β-l-rhamnose * smiles: ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=...")
(Created page with "Category:metabolite == Metabolite N-Ac-L-methionyl-L-glutaminyl-Protein == * common-name: ** an n-terminal nα-acetyl-l-methionyl-l-glutaminyl-[protein] == Reaction(s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11540 ==
+
== Metabolite N-Ac-L-methionyl-L-glutaminyl-Protein ==
 
* common-name:
 
* common-name:
** udp-4-dehydro-β-l-rhamnose
+
** an n-terminal nα-acetyl-l-methionyl-l-glutaminyl-[protein]
* smiles:
 
** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
 
* inchi-key:
 
** ddwgqqadoimfoi-tyenrrdnsa-l
 
* molecular-weight:
 
** 546.274
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10740]]
+
* [[RXN-17893]]
* [[RXN-18332]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18332]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-4-dehydro-β-l-rhamnose}}
+
{{#set: common-name=an n-terminal nα-acetyl-l-methionyl-l-glutaminyl-[protein]}}
{{#set: inchi-key=inchikey=ddwgqqadoimfoi-tyenrrdnsa-l}}
 
{{#set: molecular-weight=546.274}}
 

Revision as of 14:54, 5 January 2021

Metabolite N-Ac-L-methionyl-L-glutaminyl-Protein

  • common-name:
    • an n-terminal nα-acetyl-l-methionyl-l-glutaminyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal nα-acetyl-l-methionyl-l-glutaminyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.