Difference between revisions of "MPP-processed-mitochonrial-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-181 == * common-name: ** 4-methylumbelliferyl acetate * smiles: ** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o) * inchi-key: ** hxvzgascdag...") |
(Created page with "Category:metabolite == Metabolite LONG-CHAIN-KETONE == * common-name: ** a ketone == Reaction(s) known to consume the compound == * CARBONYL-REDUCTASE-NADPH-RXN * RX...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LONG-CHAIN-KETONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** a ketone |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[CARBONYL-REDUCTASE-NADPH-RXN]] |
| + | * [[RXN-12267]] | ||
| + | * [[RXN-12448]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[CARBONYL-REDUCTASE-NADPH-RXN]] | ||
| + | * [[RXN-12267]] | ||
| + | * [[RXN-12448]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a ketone}} |
| − | |||
| − | |||
Revision as of 18:53, 14 January 2021
Contents
Metabolite LONG-CHAIN-KETONE
- common-name:
- a ketone
