Difference between revisions of "MPT-Synthase-small-subunits"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol * smiles: ** cc(c)...")
(Created page with "Category:metabolite == Metabolite EDTA == * common-name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o * inchi-key: ** kcxvzyzypllwcc-uhfff...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ ==
+
== Metabolite EDTA ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol
+
** edta
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c
+
** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** atqqulxelmejix-nsuijkaqsa-n
+
** kcxvzyzypllwcc-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 562.874
+
** 290.229
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ExchangeSeed-EDTA]]
 +
* [[TransportSeed-EDTA]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN3O-54]]
+
* [[ExchangeSeed-EDTA]]
 +
* [[TransportSeed-EDTA]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=edta}}
{{#set: inchi-key=inchikey=atqqulxelmejix-nsuijkaqsa-n}}
+
{{#set: inchi-key=inchikey=kcxvzyzypllwcc-uhfffaoysa-l}}
{{#set: molecular-weight=562.874}}
+
{{#set: molecular-weight=290.229}}

Revision as of 08:26, 15 March 2021

Metabolite EDTA

  • common-name:
    • edta
  • smiles:
    • c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
  • inchi-key:
    • kcxvzyzypllwcc-uhfffaoysa-l
  • molecular-weight:
    • 290.229

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality