Difference between revisions of "MPT-Synthase-small-subunits"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite EDTA == * common-name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o * inchi-key: ** kcxvzyzypllwcc-uhfff...") |
(Created page with "Category:metabolite == Metabolite MPT-Synthase-small-subunits == * common-name: ** a small subunit of molybdopterin synthase == Reaction(s) known to consume the compound =...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MPT-Synthase-small-subunits == |
* common-name: | * common-name: | ||
| − | ** | + | ** a small subunit of molybdopterin synthase |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11361]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a small subunit of molybdopterin synthase}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite MPT-Synthase-small-subunits
- common-name:
- a small subunit of molybdopterin synthase
