Difference between revisions of "MPT-Synthase-small-subunits"

Revision as of 15:26, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE ==
+== Metabolite Deoxy-Ribonucleoside-Triphosphates ==
 * common-name:
-** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
+** a 2'-deoxyribonucleoside 5'-triphosphate
-* smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
-* inchi-key:
-** whmxlrrvaneoog-mvfiekmpsa-l
-* molecular-weight:
-** 715.004
 == Reaction(s) known to consume the compound ==
+* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
+* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[2.5.1.42-RXN]]
+* [[1.17.4.2-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate}}
+{{#set: common-name=a 2'-deoxyribonucleoside 5'-triphosphate}}
-{{#set: inchi-key=inchikey=whmxlrrvaneoog-mvfiekmpsa-l}}
-{{#set: molecular-weight=715.004}}