Difference between revisions of "MPT-Synthase-small-subunits"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Deoxy-Ribonucleoside-Triphosphates == * common-name: ** a 2'-deoxyribonucleoside 5'-triphosphate == Reaction(s) known to consume the comp...")
(Created page with "Category:metabolite == Metabolite EDTA == * common-name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o * inchi-key: ** kcxvzyzypllwcc-uhfff...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Deoxy-Ribonucleoside-Triphosphates ==
+
== Metabolite EDTA ==
 
* common-name:
 
* common-name:
** a 2'-deoxyribonucleoside 5'-triphosphate
+
** edta
 +
* smiles:
 +
** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
 +
* inchi-key:
 +
** kcxvzyzypllwcc-uhfffaoysa-l
 +
* molecular-weight:
 +
** 290.229
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[ExchangeSeed-EDTA]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[TransportSeed-EDTA]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.17.4.2-RXN]]
+
* [[ExchangeSeed-EDTA]]
 +
* [[TransportSeed-EDTA]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2'-deoxyribonucleoside 5'-triphosphate}}
+
{{#set: common-name=edta}}
 +
{{#set: inchi-key=inchikey=kcxvzyzypllwcc-uhfffaoysa-l}}
 +
{{#set: molecular-weight=290.229}}

Revision as of 13:09, 14 January 2021

Metabolite EDTA

  • common-name:
    • edta
  • smiles:
    • c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
  • inchi-key:
    • kcxvzyzypllwcc-uhfffaoysa-l
  • molecular-weight:
    • 290.229

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality