Difference between revisions of "MRNA-Adenines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12897 == * common-name: ** 7-methyl-3-oxooct-6-enoyl-coa * smiles: ** cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...") |
(Created page with "Category:metabolite == Metabolite 8-AMINO-7-OXONONANOATE == * common-name: ** 8-amino-7-oxononanoate * smiles: ** cc(c(cccccc([o-])=o)=o)[n+] * inchi-key: ** guahpajoxvyfo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 8-AMINO-7-OXONONANOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 8-amino-7-oxononanoate |
* smiles: | * smiles: | ||
| − | ** cc(c | + | ** cc(c(cccccc([o-])=o)=o)[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** guahpajoxvyfon-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 187.238 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DAPASYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[7KAPSYN-RXN]] | ||
| + | * [[DAPASYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=8-amino-7-oxononanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=guahpajoxvyfon-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=187.238}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite 8-AMINO-7-OXONONANOATE
- common-name:
- 8-amino-7-oxononanoate
- smiles:
- cc(c(cccccc([o-])=o)=o)[n+]
- inchi-key:
- guahpajoxvyfon-uhfffaoysa-n
- molecular-weight:
- 187.238
