Difference between revisions of "MRNA-Fragments"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07399 == * transcription-direction: ** negative * right-end-position: ** 44013 * left-end-position: ** 34598 * centisome-position: ** 50.848007...") |
(Created page with "Category:metabolite == Metabolite CPDMETA-13651 == * common-name: ** perakine * smiles: ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(c=o)3)c(c4)5)oc(=o)c))6))))) * inchi-k...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPDMETA-13651 == |
| − | * | + | * common-name: |
| − | ** | + | ** perakine |
| − | * | + | * smiles: |
| − | ** | + | ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(c=o)3)c(c4)5)oc(=o)c))6))))) |
| − | * | + | * inchi-key: |
| − | ** | + | ** gdxjmogwonjrhl-vqhwpedhsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 350.416 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-12673]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=perakine}} | |
| − | + | {{#set: inchi-key=inchikey=gdxjmogwonjrhl-vqhwpedhsa-n}} | |
| − | + | {{#set: molecular-weight=350.416}} | |
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPDMETA-13651
- common-name:
- perakine
- smiles:
- cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(c=o)3)c(c4)5)oc(=o)c))6)))))
- inchi-key:
- gdxjmogwonjrhl-vqhwpedhsa-n
- molecular-weight:
- 350.416
