Difference between revisions of "MRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6702 == * common-name: ** 1d-myo-inositol 6-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1) * inchi-key: ** in...") |
(Created page with "Category:metabolite == Metabolite mRNAs == * common-name: ** an mrna == Reaction(s) known to consume the compound == * POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN == Reacti...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite mRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an mrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.1.13.4-RXN]] | ||
| + | * [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an mrna}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite mRNAs
- common-name:
- an mrna
