Difference between revisions of "MUTATED-TRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8091 == * common-name: ** 1-oleoyl-2-linoleoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop...")
(Created page with "Category:metabolite == Metabolite MUTATED-TRNA == * common-name: ** mutated trna == Reaction(s) known to consume the compound == * RXN0-6525 == Reaction(s) known to pr...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8091 ==
+
== Metabolite MUTATED-TRNA ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-linoleoyl-phosphatidylcholine
+
** mutated trna
* smiles:
 
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** gdwulugdxghjij-vjhnmzkjsa-n
 
* molecular-weight:
 
** 784.107
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8322]]
+
* [[RXN0-6525]]
* [[RXN-8326]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8327]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-linoleoyl-phosphatidylcholine}}
+
{{#set: common-name=mutated trna}}
{{#set: inchi-key=inchikey=gdwulugdxghjij-vjhnmzkjsa-n}}
 
{{#set: molecular-weight=784.107}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite MUTATED-TRNA

  • common-name:
    • mutated trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality