Difference between revisions of "MYO-INOSITOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19168 == * common-name: ** (s)-3-hydroxy-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-5-methyluracil1939 == * common-name: ** a 5-methyluracil1939 in 23s rrna == Reaction(s) known to consume the compound == == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19168 ==
+
== Metabolite 23S-rRNA-5-methyluracil1939 ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-(7z)-hexadecenoyl-coa
+
** a 5-methyluracil1939 in 23s rrna
* smiles:
 
** ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** kzlhpkriedlqgg-squpixldsa-j
 
* molecular-weight:
 
** 1015.898
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17781]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17780]]
+
* [[RXN-11601]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-(7z)-hexadecenoyl-coa}}
+
{{#set: common-name=a 5-methyluracil1939 in 23s rrna}}
{{#set: inchi-key=inchikey=kzlhpkriedlqgg-squpixldsa-j}}
 
{{#set: molecular-weight=1015.898}}
 

Revision as of 18:58, 14 January 2021

Metabolite 23S-rRNA-5-methyluracil1939

  • common-name:
    • a 5-methyluracil1939 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality