Difference between revisions of "MYO-INOSITOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite C4 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine * smiles: ** cc(c...")
(Created page with "Category:metabolite == Metabolite MYO-INOSITOL == * common-name: ** myo-inositol * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o * inchi-key: ** cdaismweouebre-gpivlxjgsa-n * molecu...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite C4 ==
+
== Metabolite MYO-INOSITOL ==
 
* common-name:
 
* common-name:
−
** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine
+
** myo-inositol
 
* smiles:
 
* smiles:
−
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)(op(=o)([o-])oc1(oc(co)c(o)c(oc(c)c(=o)nc(c)c(=o)nc(ccc(nc(cccc[n+])c(=o)nc(c)c(nc(c(=o)[o-])c)=o)=o)c([o-])=o)c(nc(c)=o)1))[o-])c)c)c)c)c)c)c
+
** c1(c(c(c(c(c1o)o)o)o)o)o
 
* inchi-key:
 
* inchi-key:
−
** sulooaflxmqjsf-ogdyfqgpsa-k
+
** cdaismweouebre-gpivlxjgsa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 1670.034
+
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-8975]]
+
* [[2.4.1.123-RXN]]
 +
* [[2.4.1.67-RXN]]
 +
* [[2.7.8.11-RXN]]
 +
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
 +
* [[MYO-INOSITOL-OXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-8975]]
+
* [[2.4.1.67-RXN]]
 +
* [[2.4.1.82-RXN]]
 +
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
 +
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
 +
* [[RXN-10949]]
 +
* [[RXN-10952]]
 +
* [[RXN-10953]]
 +
* [[RXN-10954]]
 +
* [[RXN-7253]]
 +
* [[RXN-8281]]
 +
* [[RXN0-5408]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine}}
+
{{#set: common-name=myo-inositol}}
−
{{#set: inchi-key=inchikey=sulooaflxmqjsf-ogdyfqgpsa-k}}
+
{{#set: inchi-key=inchikey=cdaismweouebre-gpivlxjgsa-n}}
−
{{#set: molecular-weight=1670.034}}
+
{{#set: molecular-weight=180.157}}

Latest revision as of 11:16, 18 March 2021

Metabolite MYO-INOSITOL

  • common-name:
    • myo-inositol
  • smiles:
    • c1(c(c(c(c(c1o)o)o)o)o)o
  • inchi-key:
    • cdaismweouebre-gpivlxjgsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=MYO-INOSITOL&oldid=139124"