Difference between revisions of "MYO-INOSITOL"

Latest revision as of 11:16, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-19168 ==
+== Metabolite MYO-INOSITOL ==
 * common-name:
-** (s)-3-hydroxy-(7z)-hexadecenoyl-coa
+** myo-inositol
 * smiles:
-** ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** c1(c(c(c(c(c1o)o)o)o)o)o
 * inchi-key:
-** kzlhpkriedlqgg-squpixldsa-j
+** cdaismweouebre-gpivlxjgsa-n
 * molecular-weight:
-** 1015.898
+** 180.157
 == Reaction(s) known to consume the compound ==
-* [[RXN-17781]]
+* [[2.4.1.123-RXN]]
+* [[2.4.1.67-RXN]]
+* [[2.7.8.11-RXN]]
+* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+* [[MYO-INOSITOL-OXYGENASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17780]]
+* [[2.4.1.67-RXN]]
+* [[2.4.1.82-RXN]]
+* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
+* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+* [[RXN-10949]]
+* [[RXN-10952]]
+* [[RXN-10953]]
+* [[RXN-10954]]
+* [[RXN-7253]]
+* [[RXN-8281]]
+* [[RXN0-5408]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-3-hydroxy-(7z)-hexadecenoyl-coa}}
+{{#set: common-name=myo-inositol}}
-{{#set: inchi-key=inchikey=kzlhpkriedlqgg-squpixldsa-j}}
+{{#set: inchi-key=inchikey=cdaismweouebre-gpivlxjgsa-n}}
-{{#set: molecular-weight=1015.898}}
+{{#set: molecular-weight=180.157}}