Difference between revisions of "MYRICETIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11770 == * common-name: ** 7,8-dihydromonapterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifamynggotfb...") |
(Created page with "Category:metabolite == Metabolite D-SERINE == * common-name: ** d-serine * smiles: ** c(o)c([n+])c([o-])=o * inchi-key: ** mtcfgrxmjlqnbg-uwtatzphsa-n * molecular-weight:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-SERINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-serine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mtcfgrxmjlqnbg-uwtatzphsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 105.093 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[DSERDEAM-RXN]] |
| + | * [[RXN-15581]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[5.1.1.18-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-serine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mtcfgrxmjlqnbg-uwtatzphsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=105.093}} |
Revision as of 08:30, 15 March 2021
Contents
Metabolite D-SERINE
- common-name:
- d-serine
- smiles:
- c(o)c([n+])c([o-])=o
- inchi-key:
- mtcfgrxmjlqnbg-uwtatzphsa-n
- molecular-weight:
- 105.093
