Difference between revisions of "Mannosyl5-N-Glycans"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HCO3 == * common-name: ** hydrogencarbonate * smiles: ** c([o-])(=o)o * inchi-key: ** bvkzguzccusvtd-uhfffaoysa-m * molecular-weight: **...") |
(Created page with "Category:metabolite == Metabolite CPD-15637 == * common-name: ** 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15637 == |
* common-name: | * common-name: | ||
− | ** | + | ** 6-cis-tridecenoyl-coa |
* smiles: | * smiles: | ||
− | ** c([o-])(=o)o | + | ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** uuivzebypbpkll-dxazuofzsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 957.819 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-14771]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=6-cis-tridecenoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uuivzebypbpkll-dxazuofzsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=957.819}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-15637
- common-name:
- 6-cis-tridecenoyl-coa
- smiles:
- ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- uuivzebypbpkll-dxazuofzsa-j
- molecular-weight:
- 957.819