Difference between revisions of "Mannosyl5-N-Glycans"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HCO3 == * common-name: ** hydrogencarbonate * smiles: ** c([o-])(=o)o * inchi-key: ** bvkzguzccusvtd-uhfffaoysa-m * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite CPD-15637 == * common-name: ** 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HCO3 ==
+
== Metabolite CPD-15637 ==
 
* common-name:
 
* common-name:
** hydrogencarbonate
+
** 6-cis-tridecenoyl-coa
 
* smiles:
 
* smiles:
** c([o-])(=o)o
+
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** bvkzguzccusvtd-uhfffaoysa-m
+
** uuivzebypbpkll-dxazuofzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 61.017
+
** 957.819
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
+
* [[RXN-14771]]
* [[BIOTIN-CARBOXYL-RXN]]
 
* [[CARBPSYN-RXN]]
 
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 
* [[PCr]]
 
* [[PEPCARBOX-RXN]]
 
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
* [[PYRUVATE-CARBOXYLASE-RXN]]
 
* [[R524-RXN]]
 
* [[RXN-12893]]
 
* [[RXN-13202]]
 
* [[RXN-14569]]
 
* [[RXN-16909]]
 
* [[RXN0-5224]]
 
* [[RXN1G-4355]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.2.1.27-RXN]]
 
* [[ACOACXr]]
 
* [[PCr]]
 
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
* [[RXN-11213]]
 
* [[RXN-14569]]
 
* [[RXN0-5224]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hydrogencarbonate}}
+
{{#set: common-name=6-cis-tridecenoyl-coa}}
{{#set: inchi-key=inchikey=bvkzguzccusvtd-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=uuivzebypbpkll-dxazuofzsa-j}}
{{#set: molecular-weight=61.017}}
+
{{#set: molecular-weight=957.819}}

Revision as of 08:24, 15 March 2021

Metabolite CPD-15637

  • common-name:
    • 6-cis-tridecenoyl-coa
  • smiles:
    • ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • uuivzebypbpkll-dxazuofzsa-j
  • molecular-weight:
    • 957.819

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality