Difference between revisions of "Mannosyl5-N-Glycans"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TYR == * common-name: ** l-tyrosine * smiles: ** c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-] * inchi-key: ** ouycccasqsfeme-qmmmgpobsa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite Mannosyl5-N-Glycans == * common-name: ** man5glcnac2-[protein] (isomer 5a1,2) == Reaction(s) known to consume the compound == * 2.4.1.1...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Mannosyl5-N-Glycans == |
* common-name: | * common-name: | ||
| − | ** | + | ** man5glcnac2-[protein] (isomer 5a1,2) |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.4.1.101-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=man5glcnac2-[protein] (isomer 5a1,2)}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Mannosyl5-N-Glycans
- common-name:
- man5glcnac2-[protein] (isomer 5a1,2)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "man5glcnac2-[protein] (isomer 5a1,2)" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
