Difference between revisions of "Mannosyl5-N-acetyl-glucosamine2-R"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14646 == * common-name: ** 9-cis-β-carotene * smiles: ** cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)...")
(Created page with "Category:metabolite == Metabolite Mannosyl5-N-acetyl-glucosamine2-R == * common-name: ** man5glcnac3-[protein] == Reaction(s) known to consume the compound == == Reaction(...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14646 ==
+
== Metabolite Mannosyl5-N-acetyl-glucosamine2-R ==
 
* common-name:
 
* common-name:
** 9-cis-β-carotene
+
** man5glcnac3-[protein]
* smiles:
 
** cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)c))c)c
 
* inchi-key:
 
** oenhqhleoonyie-bvzamqqesa-n
 
* molecular-weight:
 
** 536.882
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13641]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13641]]
+
* [[2.4.1.101-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=9-cis-β-carotene}}
+
{{#set: common-name=man5glcnac3-[protein]}}
{{#set: inchi-key=inchikey=oenhqhleoonyie-bvzamqqesa-n}}
 
{{#set: molecular-weight=536.882}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Mannosyl5-N-acetyl-glucosamine2-R

  • common-name:
    • man5glcnac3-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "man5glcnac3-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.