Difference between revisions of "Mannosyl5-N-acetyl-glucosamine2-R"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10841 RXN-10841] == * direction: ** reversible * common-name: ** all-trans-retinol dehydrogenas...")
(Created page with "Category:metabolite == Metabolite CPD-14646 == * common-name: ** 9-cis-β-carotene * smiles: ** cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10841 RXN-10841] ==
+
== Metabolite CPD-14646 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** all-trans-retinol dehydrogenase
+
** 9-cis-β-carotene
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.300 ec-1.1.1.300]
+
** cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)c))c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-13524]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[RETINAL]][c]
+
** oenhqhleoonyie-bvzamqqesa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ13034]]
+
** 536.882
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-13641]]
−
* Gene: [[SJ12574]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-13641]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ19151]]
+
{{#set: common-name=9-cis-&beta;-carotene}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=oenhqhleoonyie-bvzamqqesa-n}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=536.882}}
−
* Gene: [[SJ02723]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-6857]], retinol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6857 PWY-6857]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6861]], the visual cycle I (vertebrates): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6861 PWY-6861]
 
−
** '''1''' reactions found over '''12''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25036 25036]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R08379 R08379]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=all-trans-retinol dehydrogenase}}
 
−
{{#set: ec-number=ec-1.1.1.300}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-14646

  • common-name:
    • 9-cis-β-carotene
  • smiles:
    • cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)c))c)c
  • inchi-key:
    • oenhqhleoonyie-bvzamqqesa-n
  • molecular-weight:
    • 536.882

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Mannosyl5-N-acetyl-glucosamine2-R&oldid=48046"