Difference between revisions of "Mannosyl5-N-acetyl-glucosamine2-R"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OXALO-SUCCINATE == * common-name: ** oxalosuccinate * smiles: ** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o * inchi-key: ** ufscuaxltrfidc-uh...")
(Created page with "Category:metabolite == Metabolite Glucosyl-acyl-sphingosines == * common-name: ** a β-d-glucosyl-n-acylsphingosine == Reaction(s) known to consume the compound == * [...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OXALO-SUCCINATE ==
+
== Metabolite Glucosyl-acyl-sphingosines ==
 
* common-name:
 
* common-name:
** oxalosuccinate
+
** a β-d-glucosyl-n-acylsphingosine
* smiles:
 
** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
 
* inchi-key:
 
** ufscuaxltrfidc-uhfffaoysa-k
 
* molecular-weight:
 
** 187.085
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8642]]
+
* [[GLUCOSYLCERAMIDASE-RXN]]
* [[RXN-9951]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8642]]
 
* [[RXN-9951]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oxalosuccinate}}
+
{{#set: common-name=a β-d-glucosyl-n-acylsphingosine}}
{{#set: inchi-key=inchikey=ufscuaxltrfidc-uhfffaoysa-k}}
 
{{#set: molecular-weight=187.085}}
 

Revision as of 15:29, 5 January 2021

Metabolite Glucosyl-acyl-sphingosines

  • common-name:
    • a β-d-glucosyl-n-acylsphingosine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality