Difference between revisions of "Mannosyl8-Nacetylglucosaminyl2"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite QUINATE == * common-name: ** l-quinate * smiles: ** c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1) * inchi-key: ** aawzdtnxlsgcek-wywmibkrsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite CPD-13927 == * common-name: ** (z)-2-methylureidoacrylate peracid * smiles: ** cc(=cnc(n)=o)c(=o)oo * inchi-key: ** ghikatudzmbujc-ihwypq...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13927 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (z)-2-methylureidoacrylate peracid |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cnc(n)=o)c(=o)oo |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ghikatudzmbujc-ihwypqmzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 160.129 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12895]] |
| + | * [[RXN-12896]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(z)-2-methylureidoacrylate peracid}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ghikatudzmbujc-ihwypqmzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=160.129}} |
Revision as of 14:56, 5 January 2021
Contents
Metabolite CPD-13927
- common-name:
- (z)-2-methylureidoacrylate peracid
- smiles:
- cc(=cnc(n)=o)c(=o)oo
- inchi-key:
- ghikatudzmbujc-ihwypqmzsa-n
- molecular-weight:
- 160.129
