Difference between revisions of "Medium-Chain-Trans-23-Dehydroacyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15543 == * transcription-direction: ** negative * right-end-position: ** 109686 * left-end-position: ** 81942 * centisome-position: ** 27.870575...")
(Created page with "Category:metabolite == Metabolite HYPOXANTHINE == * common-name: ** hypoxanthine * smiles: ** c1(nc2(=c(n=1)n=cnc(=o)2)) * inchi-key: ** fdgqstzjbfjubt-uhfffaoysa-n * mole...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ15543 ==
+
== Metabolite HYPOXANTHINE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** hypoxanthine
−
* right-end-position:
+
* smiles:
−
** 109686
+
** c1(nc2(=c(n=1)n=cnc(=o)2))
−
* left-end-position:
+
* inchi-key:
−
** 81942
+
** fdgqstzjbfjubt-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 27.870575   
+
** 136.113
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[DEOXYINOPHOSPHOR-RXN]]
−
== Reaction(s) associated ==
+
* [[HPRT]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[HYPOXANPRIBOSYLTRAN-RXN]]
−
* [[DNA-LIGASE-ATP-RXN]]
+
* [[INOPHOSPHOR-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-7682]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[XANDH]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[DEOXYINOPHOSPHOR-RXN]]
−
* [[DNA-LIGASE-NAD+-RXN]]
+
* [[HPRT]]
−
** Category: [[annotation]]
+
* [[INOPHOSPHOR-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-15712]]
+
{{#set: common-name=hypoxanthine}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=fdgqstzjbfjubt-uhfffaoysa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=136.113}}
−
* [[RXN-15713]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17917]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17918]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17919]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17920]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17921]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17922]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17923]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17924]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=109686}}
 
−
{{#set: left-end-position=81942}}
 
−
{{#set: centisome-position=27.870575    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=12}}
 

Revision as of 20:31, 18 December 2020

Metabolite HYPOXANTHINE

  • common-name:
    • hypoxanthine
  • smiles:
    • c1(nc2(=c(n=1)n=cnc(=o)2))
  • inchi-key:
    • fdgqstzjbfjubt-uhfffaoysa-n
  • molecular-weight:
    • 136.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Medium-Chain-Trans-23-Dehydroacyl-CoA&oldid=46071"