Difference between revisions of "Menaquinols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P == * common-name: ** 7,8-dihydroneopterin 3'-phosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-]...")
(Created page with "Category:metabolite == Metabolite Menaquinols == * common-name: ** a menaquinol == Reaction(s) known to consume the compound == * RXN-14107 == Reaction(s) known to pro...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDRONEOPTERIN-P ==
+
== Metabolite Menaquinols ==
 
* common-name:
 
* common-name:
** 7,8-dihydroneopterin 3'-phosphate
+
** a menaquinol
* smiles:
 
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2))
 
* inchi-key:
 
** plsqmgzyogsoce-xinawcovsa-l
 
* molecular-weight:
 
** 333.197
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+
* [[RXN-14107]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
+
* [[RXN-11046]]
 +
* [[RXN-15740]]
 +
* [[RXN0-6554]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydroneopterin 3'-phosphate}}
+
{{#set: common-name=a menaquinol}}
{{#set: inchi-key=inchikey=plsqmgzyogsoce-xinawcovsa-l}}
 
{{#set: molecular-weight=333.197}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Menaquinols

  • common-name:
    • a menaquinol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality