Difference between revisions of "Menaquinones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12935 == * common-name: ** 4'-apo-β-carotenal * smiles: ** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)...")
(Created page with "Category:metabolite == Metabolite Menaquinones == * common-name: ** a menaquinone == Reaction(s) known to consume the compound == * RXN-15740 * RXN0-6554 == Reacti...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12935 ==
+
== Metabolite Menaquinones ==
 
* common-name:
 
* common-name:
** 4'-apo-β-carotenal
+
** a menaquinone
* smiles:
 
** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)
 
* inchi-key:
 
** ftqsfezuhzhoat-brzoagjpsa-n
 
* molecular-weight:
 
** 482.748
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15740]]
 +
* [[RXN0-6554]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11989]]
+
* [[RXN-14107]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4'-apo-β-carotenal}}
+
{{#set: common-name=a menaquinone}}
{{#set: inchi-key=inchikey=ftqsfezuhzhoat-brzoagjpsa-n}}
 
{{#set: molecular-weight=482.748}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Menaquinones

  • common-name:
    • a menaquinone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality