Difference between revisions of "Menaquinones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8291 == * common-name: ** 1-18:1-2-18:1-phosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(oc...")
(Created page with "Category:metabolite == Metabolite 1-Alpha-Linolenoyl-L-Phosphatidate == * common-name: ** a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to con...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8291 ==
+
== Metabolite 1-Alpha-Linolenoyl-L-Phosphatidate ==
 
* common-name:
 
* common-name:
** 1-18:1-2-18:1-phosphatidylethanolamine
+
** a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate
* smiles:
 
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(occ[n+])([o-])=o)=o
 
* inchi-key:
 
** mwrbnpkjoowzpw-nyvomtagsa-n
 
* molecular-weight:
 
** 744.043
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15036]]
 
* [[RXN-15067]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15036]]
+
* [[RXN-16071]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:1-2-18:1-phosphatidylethanolamine}}
+
{{#set: common-name=a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=mwrbnpkjoowzpw-nyvomtagsa-n}}
 
{{#set: molecular-weight=744.043}}
 

Revision as of 15:29, 5 January 2021

Metabolite 1-Alpha-Linolenoyl-L-Phosphatidate

  • common-name:
    • a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality