Difference between revisions of "Methionine-synthase-cob-II-alamins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4581 == * common-name: ** zymosterone * smiles: ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(=o)ccc(c)1c=2ccc(c)34)))) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite CPD-13118 == * common-name: ** gdp-β-l-fucose * smiles: ** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4581 ==
+
== Metabolite CPD-13118 ==
 
* common-name:
 
* common-name:
** zymosterone
+
** gdp-β-l-fucose
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(=o)ccc(c)1c=2ccc(c)34))))
+
** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
 
* inchi-key:
 
* inchi-key:
** aunlirxijavbnm-zsbatxslsa-n
+
** lqebexmhblqmdb-jgqubwhwsa-l
 
* molecular-weight:
 
* molecular-weight:
** 382.628
+
** 587.33
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-319]]
+
* [[2.4.1.221-RXN]]
 +
* [[2.4.1.68-RXN]]
 +
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
 +
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
 +
* [[RXN-9463]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-318]]
+
* [[1.1.1.271-RXN]]
 +
* [[2.4.1.221-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=zymosterone}}
+
{{#set: common-name=gdp-β-l-fucose}}
{{#set: inchi-key=inchikey=aunlirxijavbnm-zsbatxslsa-n}}
+
{{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}}
{{#set: molecular-weight=382.628}}
+
{{#set: molecular-weight=587.33}}

Revision as of 08:28, 15 March 2021

Metabolite CPD-13118

  • common-name:
    • gdp-β-l-fucose
  • smiles:
    • cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
  • inchi-key:
    • lqebexmhblqmdb-jgqubwhwsa-l
  • molecular-weight:
    • 587.33

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality