Difference between revisions of "Methyl-thioethers"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HOMOGENTISATE == * common-name: ** homogentisate * smiles: ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) * inchi-key: ** igmnyecmumzddf-uhfffaoysa-m...") |
(Created page with "Category:metabolite == Metabolite Methyl-thioethers == * common-name: ** a methyl thioether == Reaction(s) known to consume the compound == == Reaction(s) known to produce...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Methyl-thioethers == |
* common-name: | * common-name: | ||
| − | ** | + | ** a methyl thioether |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[THIOL-S-METHYLTRANSFERASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a methyl thioether}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Methyl-thioethers
- common-name:
- a methyl thioether
