Difference between revisions of "Methyl-thioethers"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HMP == * common-name: ** 4-amino-2-methyl-5-pyrimidinemethanol * smiles: ** cc1(n=c(c(=cn=1)co)n) * inchi-key: ** vutbelpredjddh-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite HOMOGENTISATE == * common-name: ** homogentisate * smiles: ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) * inchi-key: ** igmnyecmumzddf-uhfffaoysa-m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HOMOGENTISATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** homogentisate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** igmnyecmumzddf-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 167.141 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14929]] |
| + | * [[RXN-2541]] | ||
| + | * [[RXN-2761]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]] |
| − | * [[ | + | * [[HPPD]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=homogentisate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=igmnyecmumzddf-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=167.141}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite HOMOGENTISATE
- common-name:
- homogentisate
- smiles:
- c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
- inchi-key:
- igmnyecmumzddf-uhfffaoysa-m
- molecular-weight:
- 167.141
