Difference between revisions of "Methylated-DNA-Bases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15566 == * common-name: ** (2e,4e)-tetradecadienoyl-coa * smiles: ** cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
(Created page with "Category:metabolite == Metabolite APS == * common-name: ** adenosine 5'-phosphosulfate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15566 ==
+
== Metabolite APS ==
 
* common-name:
 
* common-name:
** (2e,4e)-tetradecadienoyl-coa
+
** adenosine 5'-phosphosulfate
 
* smiles:
 
* smiles:
** cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** ulogshzmdlrqry-inbgbncrsa-j
+
** irlpacmltupbcl-kqynxxcusa-l
 
* molecular-weight:
 
* molecular-weight:
** 969.83
+
** 425.266
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14715]]
+
* [[1.8.4.9-RXN]]
 +
* [[ADENYLYLSULFATASE-RXN]]
 +
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[R163-RXN]]
 +
* [[RXN-12019]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 +
* [[SULFATE-ADENYLYLTRANSFERASE-ADP-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[R163-RXN]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,4e)-tetradecadienoyl-coa}}
+
{{#set: common-name=adenosine 5'-phosphosulfate}}
{{#set: inchi-key=inchikey=ulogshzmdlrqry-inbgbncrsa-j}}
+
{{#set: inchi-key=inchikey=irlpacmltupbcl-kqynxxcusa-l}}
{{#set: molecular-weight=969.83}}
+
{{#set: molecular-weight=425.266}}

Revision as of 08:26, 15 March 2021

Metabolite APS

  • common-name:
    • adenosine 5'-phosphosulfate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
  • inchi-key:
    • irlpacmltupbcl-kqynxxcusa-l
  • molecular-weight:
    • 425.266

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality