Difference between revisions of "Methylated-DNA-Bases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7137 == * common-name: ** pelargonidin-3,5-di-o-β-d-glucoside * smiles: ** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=...")
(Created page with "Category:metabolite == Metabolite Methylated-DNA-Bases == * common-name: ** a methylated nucleobase within dna == Reaction(s) known to consume the compound == * RXN-1235...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7137 ==
+
== Metabolite Methylated-DNA-Bases ==
 
* common-name:
 
* common-name:
** pelargonidin-3,5-di-o-β-d-glucoside
+
** a methylated nucleobase within dna
* smiles:
 
** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o)
 
* inchi-key:
 
** slckjkwfulxzbd-zotffytfsa-n
 
* molecular-weight:
 
** 594.525
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12353]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7828]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pelargonidin-3,5-di-o-β-d-glucoside}}
+
{{#set: common-name=a methylated nucleobase within dna}}
{{#set: inchi-key=inchikey=slckjkwfulxzbd-zotffytfsa-n}}
 
{{#set: molecular-weight=594.525}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Methylated-DNA-Bases

  • common-name:
    • a methylated nucleobase within dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality