Difference between revisions of "Methylated-DNA-Bases"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09995 == * transcription-direction: ** positive * right-end-position: ** 320512 * left-end-position: ** 313564 * centisome-position: ** 78.44709...") |
(Created page with "Category:metabolite == Metabolite CPD-7137 == * common-name: ** pelargonidin-3,5-di-o-β-d-glucoside * smiles: ** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-7137 == |
− | * | + | * common-name: |
− | ** | + | ** pelargonidin-3,5-di-o-β-d-glucoside |
− | + | * smiles: | |
− | + | ** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o) | |
− | + | * inchi-key: | |
− | + | ** slckjkwfulxzbd-zotffytfsa-n | |
− | * | + | * molecular-weight: |
− | ** | + | ** 594.525 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-7828]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=pelargonidin-3,5-di-o-β-d-glucoside}} |
− | + | {{#set: inchi-key=inchikey=slckjkwfulxzbd-zotffytfsa-n}} | |
− | ** | + | {{#set: molecular-weight=594.525}} |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-7137
- common-name:
- pelargonidin-3,5-di-o-β-d-glucoside
- smiles:
- c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o)
- inchi-key:
- slckjkwfulxzbd-zotffytfsa-n
- molecular-weight:
- 594.525