Difference between revisions of "Methylated-DNA-Bases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7137 == * common-name: ** pelargonidin-3,5-di-o-β-d-glucoside * smiles: ** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=...")
(Created page with "Category:metabolite == Metabolite APS == * common-name: ** adenosine 5'-phosphosulfate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7137 ==
+
== Metabolite APS ==
 
* common-name:
 
* common-name:
** pelargonidin-3,5-di-o-β-d-glucoside
+
** adenosine 5'-phosphosulfate
 
* smiles:
 
* smiles:
** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o)
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** slckjkwfulxzbd-zotffytfsa-n
+
** irlpacmltupbcl-kqynxxcusa-l
 
* molecular-weight:
 
* molecular-weight:
** 594.525
+
** 425.266
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.8.4.9-RXN]]
 +
* [[ADENYLYLSULFATASE-RXN]]
 +
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[R163-RXN]]
 +
* [[RXN-12019]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 +
* [[SULFATE-ADENYLYLTRANSFERASE-ADP-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7828]]
+
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[R163-RXN]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pelargonidin-3,5-di-o-β-d-glucoside}}
+
{{#set: common-name=adenosine 5'-phosphosulfate}}
{{#set: inchi-key=inchikey=slckjkwfulxzbd-zotffytfsa-n}}
+
{{#set: inchi-key=inchikey=irlpacmltupbcl-kqynxxcusa-l}}
{{#set: molecular-weight=594.525}}
+
{{#set: molecular-weight=425.266}}

Revision as of 13:09, 14 January 2021

Metabolite APS

  • common-name:
    • adenosine 5'-phosphosulfate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
  • inchi-key:
    • irlpacmltupbcl-kqynxxcusa-l
  • molecular-weight:
    • 425.266

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality