Difference between revisions of "Mitochondrial-Preproteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12581 == * common-name: ** s-(2e,6e)-farnesyl-l-cysteine * smiles: ** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** sysl...") |
(Created page with "Category:metabolite == Metabolite Mitochondrial-Preproteins == * common-name: ** a mitochondrial preprotein including a mitochondrial targeting sequence == Reaction(s) kno...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Mitochondrial-Preproteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a mitochondrial preprotein including a mitochondrial targeting sequence |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.4.24.64-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a mitochondrial preprotein including a mitochondrial targeting sequence}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Mitochondrial-Preproteins
- common-name:
- a mitochondrial preprotein including a mitochondrial targeting sequence
