Difference between revisions of "Mitochondrial-Preproteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17866 == * common-name: ** s-sulfinatoglutathione * smiles: ** c(ss([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Mitochondrial-Preproteins == * common-name: ** a mitochondrial preprotein including a mitochondrial targeting sequence == Reaction(s) kno...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Mitochondrial-Preproteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a mitochondrial preprotein including a mitochondrial targeting sequence |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[3.4.24.64-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a mitochondrial preprotein including a mitochondrial targeting sequence}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Mitochondrial-Preproteins
- common-name:
- a mitochondrial preprotein including a mitochondrial targeting sequence
