Difference between revisions of "Mitochondrial-Preproteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12581 == * common-name: ** s-(2e,6e)-farnesyl-l-cysteine * smiles: ** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** sysl...") |
(Created page with "Category:metabolite == Metabolite CPD-17866 == * common-name: ** s-sulfinatoglutathione * smiles: ** c(ss([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-17866 == |
* common-name: | * common-name: | ||
− | ** s- | + | ** s-sulfinatoglutathione |
* smiles: | * smiles: | ||
− | ** | + | ** c(ss([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qubutnszzfichl-wdskdsinsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 369.364 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[FESGSHTHIO-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=s- | + | {{#set: common-name=s-sulfinatoglutathione}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qubutnszzfichl-wdskdsinsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=369.364}} |
Revision as of 14:53, 5 January 2021
Contents
Metabolite CPD-17866
- common-name:
- s-sulfinatoglutathione
- smiles:
- c(ss([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
- inchi-key:
- qubutnszzfichl-wdskdsinsa-l
- molecular-weight:
- 369.364