Difference between revisions of "Monoamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-511 == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co * inchi-key: ** znxzgrmvnnhpca-vifpvbqesa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite Guanine46-in-tRNA == * common-name: ** a guanine46 in trna == Reaction(s) known to consume the compound == * TRNA-GUANINE-N7--METHYLTRA...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Guanine46-in-tRNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** a guanine46 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a guanine46 in trna}} |
| − | |||
| − | |||
Revision as of 08:26, 15 March 2021
Contents
Metabolite Guanine46-in-tRNA
- common-name:
- a guanine46 in trna
