Difference between revisions of "Monoamines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-511 == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co * inchi-key: ** znxzgrmvnnhpca-vifpvbqesa-n * molecu...")
(Created page with "Category:metabolite == Metabolite Monoamines == * common-name: ** a monoamine == Reaction(s) known to consume the compound == * RXN-9598 == Reaction(s) known to produc...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-511 ==
+
== Metabolite Monoamines ==
 
* common-name:
 
* common-name:
** pantetheine
+
** a monoamine
* smiles:
 
** cc(c(o)c(=o)nccc(nccs)=o)(c)co
 
* inchi-key:
 
** znxzgrmvnnhpca-vifpvbqesa-n
 
* molecular-weight:
 
** 278.366
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PANTETHEINE-KINASE-RXN]]
+
* [[RXN-9598]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PANTETHEINE-KINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pantetheine}}
+
{{#set: common-name=a monoamine}}
{{#set: inchi-key=inchikey=znxzgrmvnnhpca-vifpvbqesa-n}}
 
{{#set: molecular-weight=278.366}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Monoamines

  • common-name:
    • a monoamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality