Difference between revisions of "Monoamines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-hexaprenyl-4-hydroxybenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(...")
(Created page with "Category:metabolite == Metabolite 2R-3R-Dihydroflavonols == * common-name: ** a (2r,3r)-dihydroflavonol == Reaction(s) known to consume the compound == * RXN-17678 ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE ==
+
== Metabolite 2R-3R-Dihydroflavonols ==
 
* common-name:
 
* common-name:
** 3-hexaprenyl-4-hydroxybenzoate
+
** a (2r,3r)-dihydroflavonol
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
 
* inchi-key:
 
** lkmqqqabigihgl-laaqxviisa-m
 
* molecular-weight:
 
** 545.824
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17678]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9003]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hexaprenyl-4-hydroxybenzoate}}
+
{{#set: common-name=a (2r,3r)-dihydroflavonol}}
{{#set: inchi-key=inchikey=lkmqqqabigihgl-laaqxviisa-m}}
 
{{#set: molecular-weight=545.824}}
 

Revision as of 13:09, 14 January 2021

Metabolite 2R-3R-Dihydroflavonols

  • common-name:
    • a (2r,3r)-dihydroflavonol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality