Difference between revisions of "Monocarboxylates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite UREA == * common-name: ** urea * smiles: ** c(=o)(n)n * inchi-key: ** xsqukjjjfzcrtk-uhfffaoysa-n * molecular-weight: ** 60.055 == Reacti...") |
(Created page with "Category:metabolite == Metabolite CPD-9700 == * common-name: ** hypoglycin b * smiles: ** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1) * inchi-key: ** uydzycpiqsrxku-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9700 == |
* common-name: | * common-name: | ||
| − | ** | + | ** hypoglycin b |
* smiles: | * smiles: | ||
| − | ** c(=o)(n) | + | ** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uydzycpiqsrxku-nppuscpjsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 269.277 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9157]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hypoglycin b}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uydzycpiqsrxku-nppuscpjsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=269.277}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-9700
- common-name:
- hypoglycin b
- smiles:
- c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1)
- inchi-key:
- uydzycpiqsrxku-nppuscpjsa-m
- molecular-weight:
- 269.277
