Difference between revisions of "Monocarboxylates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2184 == * common-name: ** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate * smiles: ** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o...")
(Created page with "Category:metabolite == Metabolite Monocarboxylates == * common-name: ** a monocarboxylate == Reaction(s) known to consume the compound == == Reaction(s) known to produce t...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2184 ==
+
== Metabolite Monocarboxylates ==
 
* common-name:
 
* common-name:
** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
+
** a monocarboxylate
* smiles:
 
** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
 
* inchi-key:
 
** wcjyzufkktynlb-aritwgjrsa-l
 
* molecular-weight:
 
** 210.143
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12070]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[AMIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}}
+
{{#set: common-name=a monocarboxylate}}
{{#set: inchi-key=inchikey=wcjyzufkktynlb-aritwgjrsa-l}}
 
{{#set: molecular-weight=210.143}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Monocarboxylates

  • common-name:
    • a monocarboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality