Difference between revisions of "Monocarboxylic-Acid-Amides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-316 == * common-name: ** reduced riboflavin * smiles: ** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-371 == * common-name: ** 1-octanal * smiles: ** ccccccc[ch]=o * inchi-key: ** nujgjrnetvairj-uhfffaoysa-n * molecular-weight: ** 128....") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-371 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-octanal |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccc[ch]=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nujgjrnetvairj-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 128.214 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[R222-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-octanal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nujgjrnetvairj-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=128.214}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite CPD-371
- common-name:
- 1-octanal
- smiles:
- ccccccc[ch]=o
- inchi-key:
- nujgjrnetvairj-uhfffaoysa-n
- molecular-weight:
- 128.214
