Difference between revisions of "Monocarboxylic-Acid-Amides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9510 RXN-9510] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/1.5.1...")
(Created page with "Category:metabolite == Metabolite CPD-316 == * common-name: ** reduced riboflavin * smiles: ** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c) * inchi-key: **...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9510 RXN-9510] ==
+
== Metabolite CPD-316 ==
* direction:
+
* common-name:
** reversible
+
** reduced riboflavin
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.5.1.42 ec-1.5.1.42]
+
** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c)
== Reaction formula ==
+
* inchi-key:
* 1 [[FMNH2]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[FMN]][c] '''+''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c]
+
** utkdoucgqvljin-pigzvrmjsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ22257]]
+
** 378.384
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
* [[PWY-7723]], bacterial bioluminescence: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7723 PWY-7723]
+
* [[RXN-12445]]
** '''2''' reactions found over '''8''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
== Reconstruction information  ==
+
{{#set: common-name=reduced riboflavin}}
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=utkdoucgqvljin-pigzvrmjsa-n}}
== External links  ==
+
{{#set: molecular-weight=378.384}}
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R05705 R05705]
 
{{#set: direction=reversible}}
 
{{#set: ec-number=ec-1.5.1.42}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-316

  • common-name:
    • reduced riboflavin
  • smiles:
    • cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c)
  • inchi-key:
    • utkdoucgqvljin-pigzvrmjsa-n
  • molecular-weight:
    • 378.384

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality