Difference between revisions of "Myelin-N-o-methyl-arginines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1516-DIHYDROBILIVERDIN == * common-name: ** 15,16-dihydrobiliverdin * smiles: ** c=cc1(=c(c)c(nc1=cc4(=c(c)c(ccc(=o)[o-])=c(c=c2(c(ccc(=o...") |
(Created page with "Category:metabolite == Metabolite CPD-11712 == * common-name: ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11712 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dowccbnjuzolrj-mlagypmbsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 396.612 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14917]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14929]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dowccbnjuzolrj-mlagypmbsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=396.612}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite CPD-11712
- common-name:
- 2-methyl-6-geranylgeranyl-1,4-benzoquinol
- smiles:
- cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))c)c
- inchi-key:
- dowccbnjuzolrj-mlagypmbsa-n
- molecular-weight:
- 396.612
