Difference between revisions of "Myelin-N-o-methyl-arginines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11712 == * common-name: ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))...")
(Created page with "Category:metabolite == Metabolite Myelin-N-o-methyl-arginines == * common-name: ** [myelin basic protein]-nω-methyl-arginine == Reaction(s) known to consume the comp...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11712 ==
+
== Metabolite Myelin-N-o-methyl-arginines ==
 
* common-name:
 
* common-name:
** 2-methyl-6-geranylgeranyl-1,4-benzoquinol
+
** [myelin basic protein]-nω-methyl-arginine
* smiles:
 
** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))c)c
 
* inchi-key:
 
** dowccbnjuzolrj-mlagypmbsa-n
 
* molecular-weight:
 
** 396.612
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14917]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14929]]
+
* [[2.1.1.126-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}}
+
{{#set: common-name=[myelin basic protein]-nω-methyl-arginine}}
{{#set: inchi-key=inchikey=dowccbnjuzolrj-mlagypmbsa-n}}
 
{{#set: molecular-weight=396.612}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Myelin-N-o-methyl-arginines

  • common-name:
    • [myelin basic protein]-nω-methyl-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "myelin basic protein]-nω-methyl-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.