Difference between revisions of "Myo-inositol-monophosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14706 == * common-name: ** 4-hydroxy-2-nonenal-[l-cys] conjugate * smiles: ** cccccc(o)c(cc=o)scc([n+])c(=o)[o-] * inchi-key: ** salp...") |
(Created page with "Category:metabolite == Metabolite Myo-inositol-monophosphates == * common-name: ** a myo-inositol monophosphate == Reaction(s) known to consume the compound == * RXN-109...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Myo-inositol-monophosphates == |
* common-name: | * common-name: | ||
− | ** | + | ** a myo-inositol monophosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10949]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a myo-inositol monophosphate}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Myo-inositol-monophosphates
- common-name:
- a myo-inositol monophosphate