Difference between revisions of "Myo-inositol-monophosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06989 == * transcription-direction: ** positive * right-end-position: ** 52783 * left-end-position: ** 24690 * centisome-position: ** 5.2922416...")
(Created page with "Category:metabolite == Metabolite 3-KETO-ADIPYL-COA == * common-name: ** 3-oxoadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06989 ==
+
== Metabolite 3-KETO-ADIPYL-COA ==
* transcription-direction:
+
* common-name:
** positive
+
** 3-oxoadipyl-coa
* right-end-position:
+
* smiles:
** 52783
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 24690
+
** vkkkaapgxhwxoo-biewrjsysa-i
* centisome-position:
+
* molecular-weight:
** 5.2922416   
+
** 904.605
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN0-2044]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[RXN0-2044]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxoadipyl-coa}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=vkkkaapgxhwxoo-biewrjsysa-i}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=904.605}}
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=52783}}
 
{{#set: left-end-position=24690}}
 
{{#set: centisome-position=5.2922416    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:32, 18 December 2020

Metabolite 3-KETO-ADIPYL-COA

  • common-name:
    • 3-oxoadipyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • vkkkaapgxhwxoo-biewrjsysa-i
  • molecular-weight:
    • 904.605

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality