Difference between revisions of "Myosin-heavy-chains"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * smiles: ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** ovboqva...") |
(Created page with "Category:metabolite == Metabolite Myosin-heavy-chains == * common-name: ** a myosin heavy chain == Reaction(s) known to consume the compound == * 2.7.11.7-RXN == React...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Myosin-heavy-chains == |
* common-name: | * common-name: | ||
− | ** | + | ** a myosin heavy chain |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.7.11.7-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.7.11.7-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a myosin heavy chain}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Myosin-heavy-chains
- common-name:
- a myosin heavy chain