Difference between revisions of "Myosin-heavy-chains"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ22264 == * transcription-direction: ** positive * right-end-position: ** 366888 * left-end-position: ** 356999 * centisome-position: ** 61.268764...")
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * smiles: ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** ovboqva...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ22264 ==
+
== Metabolite CPD-7247 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** all-trans-13,14-dihydroretinol
−
* right-end-position:
+
* smiles:
−
** 366888
+
** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1)
−
* left-end-position:
+
* inchi-key:
−
** 356999
+
** ovboqvaiymsudt-hrygcdposa-n
−
* centisome-position:
+
* molecular-weight:
−
** 61.268764   
+
** 288.472
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[1.3.99.23-RXN]]
−
* [[6PGLUCONDEHYDROG-RXN]]
+
* [[RETINOLSAT]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=all-trans-13,14-dihydroretinol}}
−
* [[PYRROLINECARBREDUCT-RXN]]
+
{{#set: inchi-key=inchikey=ovboqvaiymsudt-hrygcdposa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=288.472}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-9952]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-546]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[P122-PWY]]
 
−
** '''16''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY-3341]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PROSYN-PWY]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6344]]
 
−
** '''2''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-4981]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[ARG-PRO-PWY]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[OXIDATIVEPENT-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=366888}}
 
−
{{#set: left-end-position=356999}}
 
−
{{#set: centisome-position=61.268764    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=7}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-7247

  • common-name:
    • all-trans-13,14-dihydroretinol
  • smiles:
    • cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1)
  • inchi-key:
    • ovboqvaiymsudt-hrygcdposa-n
  • molecular-weight:
    • 288.472

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Myosin-heavy-chains&oldid=46006"