Difference between revisions of "Myosin-heavy-chains"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22264 == * transcription-direction: ** positive * right-end-position: ** 366888 * left-end-position: ** 356999 * centisome-position: ** 61.268764...") |
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * smiles: ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** ovboqva...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-7247 == |
− | * | + | * common-name: |
− | ** | + | ** all-trans-13,14-dihydroretinol |
− | * | + | * smiles: |
− | ** | + | ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) |
− | * | + | * inchi-key: |
− | ** | + | ** ovboqvaiymsudt-hrygcdposa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 288.472 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[1.3.99.23-RXN]] |
− | * [[ | + | * [[RETINOLSAT]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=all-trans-13,14-dihydroretinol}} | |
− | + | {{#set: inchi-key=inchikey=ovboqvaiymsudt-hrygcdposa-n}} | |
− | + | {{#set: molecular-weight=288.472}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:31, 18 December 2020
Contents
Metabolite CPD-7247
- common-name:
- all-trans-13,14-dihydroretinol
- smiles:
- cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1)
- inchi-key:
- ovboqvaiymsudt-hrygcdposa-n
- molecular-weight:
- 288.472