Difference between revisions of "N-4-aminobutylidene-eIF5A-lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9859 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(...") |
(Created page with "Category:metabolite == Metabolite MYRICETIN == * common-name: ** myricetin * smiles: ** c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3))) * inchi-key: ** ikmd...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MYRICETIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** myricetin |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ikmdfbphznjcsn-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 317.231 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8450]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=myricetin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ikmdfbphznjcsn-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=317.231}} |
Revision as of 11:18, 15 January 2021
Contents
Metabolite MYRICETIN
- common-name:
- myricetin
- smiles:
- c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3)))
- inchi-key:
- ikmdfbphznjcsn-uhfffaoysa-m
- molecular-weight:
- 317.231
